CAS 170569-87-6 appears in our catalog under these names: Celecoxib Impurity 3, Desmethyl Celecoxib, Desmethyl Celecoxib/ 99.98% (existing batch purity), CAY10452, 4-(5-Phenyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide, 98%, 98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 50mg, 25mg, 100mg, 10mg, 5mg, 10mM (in 1ml dmso), 10mM/1mL.
4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CAS 170569-87-6) is a chemical compound with the molecular formula C16H12F3N3O2S and a molecular weight of 367.3 g/mol. IUPAC name: 4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide. InChIKey: MQPLMBSDWYIIID-UHFFFAOYSA-N.
| Molecular formula | C16H12F3N3O2S |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | 4-[5-phenyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChIKey | MQPLMBSDWYIIID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)