CAS 170571-19-4 is the registry number for 1-[4-(Aminosulfonyl)phenyl]-5-(4-chlorophenyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylic acid (CAS 170571-19-4) is a chemical compound with the molecular formula C16H12ClN3O4S and a molecular weight of 377.8 g/mol. IUPAC name: 5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylic acid. InChIKey: NHAUQESLCOSREJ-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O4S |
|---|---|
| Molecular weight | 377.8 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)pyrazole-3-carboxylic acid |
| InChIKey | NHAUQESLCOSREJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(=O)O)Cl |
Computed by PubChem (NCBI)