CAS 170629-24-0 appears in our catalog under these names: (4-((4-Chlorophenyl)ethynyl)phenyl)boronic acid, 95%, 95%, (4-((4-Chlorophenyl)ethynyl)phenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[4-[2-(4-chlorophenyl)ethynyl]phenyl]boronic acid (CAS 170629-24-0) is a chemical compound with the molecular formula C14H10BClO2 and a molecular weight of 256.49 g/mol. IUPAC name: [4-[2-(4-chlorophenyl)ethynyl]phenyl]boronic acid. InChIKey: FQRPGGVMEAIOQD-UHFFFAOYSA-N.
| Molecular formula | C14H10BClO2 |
|---|---|
| Molecular weight | 256.49 g/mol |
| IUPAC name | [4-[2-(4-chlorophenyl)ethynyl]phenyl]boronic acid |
| InChIKey | FQRPGGVMEAIOQD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C#CC2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)