Products 1706432-00-9
CAS 1706432-00-9 is the registry number for N-(5-Amino-2-fluorophenyl)-n-methylacrylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(5-amino-2-fluorophenyl)-N-methylprop-2-enamide (CAS 1706432-00-9) is a chemical compound with the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. IUPAC name: N-(5-amino-2-fluorophenyl)-N-methylprop-2-enamide. InChIKey: ZFGNAUDLKKAVJC-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | N-(5-amino-2-fluorophenyl)-N-methylprop-2-enamide |
| InChIKey | ZFGNAUDLKKAVJC-UHFFFAOYSA-N |
| SMILES | CN(C1=C(C=CC(=C1)N)F)C(=O)C=C |
Computed by PubChem (NCBI)