CAS 1706439-37-3 is the registry number for Ethyl 3-(trans-2-fluorocyclopropyl)-3-oxopropanoate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Ethyl 3-[(1S,2R)-2-fluorocyclopropyl]-3-oxopropanoate (CAS 1706439-37-3) is a chemical compound with the molecular formula C8H11FO3 and a molecular weight of 174.17 g/mol. IUPAC name: ethyl 3-[(1S,2R)-2-fluorocyclopropyl]-3-oxopropanoate. InChIKey: WKEXZXHWDVGSCK-PHDIDXHHSA-N.
| Molecular formula | C8H11FO3 |
|---|---|
| Molecular weight | 174.17 g/mol |
| IUPAC name | ethyl 3-[(1S,2R)-2-fluorocyclopropyl]-3-oxopropanoate |
| InChIKey | WKEXZXHWDVGSCK-PHDIDXHHSA-N |
| SMILES | CCOC(=O)CC(=O)[C@@H]1C[C@H]1F |
Computed by PubChem (NCBI)