CAS 1706458-14-1 appears in our catalog under these names: 3,4-Dichloro-5-(trifluoromethoxy)benzonitrile, 95%, 3,4-Dichloro-5-(trifluoromethoxy)benzonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3,4-dichloro-5-(trifluoromethoxy)benzonitrile (CAS 1706458-14-1) is a chemical compound with the molecular formula C8H2Cl2F3NO and a molecular weight of 256.01 g/mol. IUPAC name: 3,4-dichloro-5-(trifluoromethoxy)benzonitrile. InChIKey: FADLYMJUOGDQJL-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F3NO |
|---|---|
| Molecular weight | 256.01 g/mol |
| IUPAC name | 3,4-dichloro-5-(trifluoromethoxy)benzonitrile |
| InChIKey | FADLYMJUOGDQJL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)(F)F)Cl)Cl)C#N |
Computed by PubChem (NCBI)