CAS 1706458-23-2 appears in our catalog under these names: 3-Chloro-5-fluoro-4-methoxybenzenesulfonyl chloride, 95%, 3-Chloro-5-fluoro-4-methoxybenzene-1-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-chloro-5-fluoro-4-methoxybenzenesulfonyl chloride (CAS 1706458-23-2) is a chemical compound with the molecular formula C7H5Cl2FO3S and a molecular weight of 259.08 g/mol. IUPAC name: 3-chloro-5-fluoro-4-methoxybenzenesulfonyl chloride. InChIKey: NKLWOLDUHBGVAQ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2FO3S |
|---|---|
| Molecular weight | 259.08 g/mol |
| IUPAC name | 3-chloro-5-fluoro-4-methoxybenzenesulfonyl chloride |
| InChIKey | NKLWOLDUHBGVAQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)