CAS 1706461-12-2 is the registry number for tert-Butyl 3-amino-1-methyl-1H,4H,5H,6H,7H-pyrazolo(4,3-c)pyridine-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-amino-1-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (CAS 1706461-12-2) is a chemical compound with the molecular formula C12H20N4O2 and a molecular weight of 252.31 g/mol. IUPAC name: tert-butyl 3-amino-1-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate. InChIKey: MKSSGIMAPLQGBM-UHFFFAOYSA-N.
| Molecular formula | C12H20N4O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | tert-butyl 3-amino-1-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| InChIKey | MKSSGIMAPLQGBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(=NN2C)N |
Computed by PubChem (NCBI)