Products 170699-07-7
CAS 170699-07-7 is the registry number for Methyl 2-Acetamido-3-(3,4-diacetoxyphenyl)-2-propenoate. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
Methyl (Z)-2-acetamido-3-(3,4-diacetyloxyphenyl)prop-2-enoate (CAS 170699-07-7) is a chemical compound with the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. IUPAC name: methyl (Z)-2-acetamido-3-(3,4-diacetyloxyphenyl)prop-2-enoate. InChIKey: VBOWSRTYMGLZOV-QPEQYQDCSA-N.
| Molecular formula | C16H17NO7 |
|---|---|
| Molecular weight | 335.31 g/mol |
| IUPAC name | methyl (Z)-2-acetamido-3-(3,4-diacetyloxyphenyl)prop-2-enoate |
| InChIKey | VBOWSRTYMGLZOV-QPEQYQDCSA-N |
| SMILES | CC(=O)N/C(=C\C1=CC(=C(C=C1)OC(=O)C)OC(=O)C)/C(=O)OC |
Computed by PubChem (NCBI)