CAS 1707-40-0 appears in our catalog under these names: 1-Adamantan-1-yl-ethanone oxime, 95%, 1-Adamantyl Methyl Ketoxime. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 50mg.
(NE)-N-[1-(1-adamantyl)ethylidene]hydroxylamine (CAS 1707-40-0) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: (NE)-N-[1-(1-adamantyl)ethylidene]hydroxylamine. InChIKey: NOWUKHMRBUCWRA-MDWZMJQESA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | (NE)-N-[1-(1-adamantyl)ethylidene]hydroxylamine |
| InChIKey | NOWUKHMRBUCWRA-MDWZMJQESA-N |
| SMILES | C/C(=N\O)/C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)