CAS 17070-56-3 appears in our catalog under these names: 3,4-Dihydronaphthalene-2-sulfonyl chloride, 95%, 3,4-Dihydronaphthalene-2-sulfonyl chloride, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g.
3,4-dihydronaphthalene-2-sulfonyl chloride (CAS 17070-56-3) is a chemical compound with the molecular formula C10H9ClO2S and a molecular weight of 228.70 g/mol. IUPAC name: 3,4-dihydronaphthalene-2-sulfonyl chloride. InChIKey: XFOWQBUKLCPMED-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2S |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | 3,4-dihydronaphthalene-2-sulfonyl chloride |
| InChIKey | XFOWQBUKLCPMED-UHFFFAOYSA-N |
| SMILES | C1CC(=CC2=CC=CC=C21)S(=O)(=O)Cl |
Computed by PubChem (NCBI)