CAS 1707358-57-3 appears in our catalog under these names: 2-[(1R*,4R*)-4-Aminocyclohexyl]-5-fluoroisoindolin-1-one hydrochloride, 95%, 2-(trans-4-Aminocyclohexyl)-5-fluoroisoindolin-1-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-(4-aminocyclohexyl)-5-fluoro-3H-isoindol-1-one;hydrochloride (CAS 1707358-57-3) is a chemical compound with the molecular formula C14H18ClFN2O and a molecular weight of 284.75 g/mol. IUPAC name: 2-(4-aminocyclohexyl)-5-fluoro-3H-isoindol-1-one;hydrochloride. InChIKey: MJTVVPQQAILYQN-UHFFFAOYSA-N.
| Molecular formula | C14H18ClFN2O |
|---|---|
| Molecular weight | 284.75 g/mol |
| IUPAC name | 2-(4-aminocyclohexyl)-5-fluoro-3H-isoindol-1-one;hydrochloride |
| InChIKey | MJTVVPQQAILYQN-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)N2CC3=C(C2=O)C=CC(=C3)F.Cl |
Computed by PubChem (NCBI)