Products 1707562-54-6
CAS 1707562-54-6 is the registry number for 7-(2-Chlorophenyl)-2-piperazin-1-ylthieno[3,2-d]pyrimidin-4(3h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-(2-chlorophenyl)-2-piperazin-1-yl-3H-thieno[3,2-d]pyrimidin-4-one (CAS 1707562-54-6) is a chemical compound with the molecular formula C16H15ClN4OS and a molecular weight of 346.8 g/mol. IUPAC name: 7-(2-chlorophenyl)-2-piperazin-1-yl-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: OKEAPVNFGWQEMK-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN4OS |
|---|---|
| Molecular weight | 346.8 g/mol |
| IUPAC name | 7-(2-chlorophenyl)-2-piperazin-1-yl-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | OKEAPVNFGWQEMK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(C(=O)N2)SC=C3C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)