CAS 1707575-97-0 appears in our catalog under these names: 4-(Piperidin-1-yl)pyridin-3-amine dihydrochloride, 95%, 4-(Piperidin-1-yl)pyridin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-piperidin-1-ylpyridin-3-amine;dihydrochloride (CAS 1707575-97-0) is a chemical compound with the molecular formula C10H17Cl2N3 and a molecular weight of 250.17 g/mol. IUPAC name: 4-piperidin-1-ylpyridin-3-amine;dihydrochloride. InChIKey: ZFEOZORSYHNHLL-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl2N3 |
|---|---|
| Molecular weight | 250.17 g/mol |
| IUPAC name | 4-piperidin-1-ylpyridin-3-amine;dihydrochloride |
| InChIKey | ZFEOZORSYHNHLL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)