CAS 17082-09-6 appears in our catalog under these names: Cinnamoyl chloride, 95%, (E)-Cinnamoyl Chloride, trans-Cinnamoyl chloride, 97% , Cinnamoyl Chloride, >97.0%(T), (E)-Cinnamoyl chloride 95%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 250g, 50g, 5g, 2500g, 100g, 500g, 10g.
(E)-3-phenylprop-2-enoyl chloride (CAS 17082-09-6) is a chemical compound with the molecular formula C9H7ClO and a molecular weight of 166.60 g/mol. IUPAC name: (E)-3-phenylprop-2-enoyl chloride. InChIKey: WOGITNXCNOTRLK-VOTSOKGWSA-N.
| Molecular formula | C9H7ClO |
|---|---|
| Molecular weight | 166.60 g/mol |
| IUPAC name | (E)-3-phenylprop-2-enoyl chloride |
| InChIKey | WOGITNXCNOTRLK-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)Cl |
Computed by PubChem (NCBI)