Products 1708401-66-4
CAS 1708401-66-4 is the registry number for 3-[(3,4-Dimethylphenyl)sulfonyl]-8-fluoroquinolin-4(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3,4-dimethylphenyl)sulfonyl-8-fluoro-1H-quinolin-4-one (CAS 1708401-66-4) is a chemical compound with the molecular formula C17H14FNO3S and a molecular weight of 331.4 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)sulfonyl-8-fluoro-1H-quinolin-4-one. InChIKey: CZBNZGDBKDUQCC-UHFFFAOYSA-N.
| Molecular formula | C17H14FNO3S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)sulfonyl-8-fluoro-1H-quinolin-4-one |
| InChIKey | CZBNZGDBKDUQCC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)C2=CNC3=C(C2=O)C=CC=C3F)C |
Computed by PubChem (NCBI)