CAS 1708401-67-5 is the registry number for 6-Fluoro-1-(4-methylphenyl)-1h-4,1,2-benzothiadiazine-3-carboxylic acid 4,4-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-fluoro-1-(4-methylphenyl)-4,4-dioxo-4lambda6,1,2-benzothiadiazine-3-carboxylic acid (CAS 1708401-67-5) is a chemical compound with the molecular formula C15H11FN2O4S and a molecular weight of 334.3 g/mol. IUPAC name: 6-fluoro-1-(4-methylphenyl)-4,4-dioxo-4lambda6,1,2-benzothiadiazine-3-carboxylic acid. InChIKey: ZYNZMUDFZWRRPN-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O4S |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 6-fluoro-1-(4-methylphenyl)-4,4-dioxo-4lambda6,1,2-benzothiadiazine-3-carboxylic acid |
| InChIKey | ZYNZMUDFZWRRPN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C3=C(C=C(C=C3)F)S(=O)(=O)C(=N2)C(=O)O |
Computed by PubChem (NCBI)