CAS 170847-18-4 appears in our catalog under these names: rac-APICA, (RS)-APICA, 98%, (RS)–APICA, (RS)-APICA, 99%, 99%, (RS)-APICA, 99.99%. Offered by: TRC, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 750mg, 100mg, 10mg, 50mg, 1mg, 5mg, 25mg, 25 mg.
1-amino-5-phosphono-2,3-dihydroindene-1-carboxylic acid (CAS 170847-18-4) is a chemical compound with the molecular formula C10H12NO5P and a molecular weight of 257.18 g/mol. IUPAC name: 1-amino-5-phosphono-2,3-dihydroindene-1-carboxylic acid. InChIKey: ZNQZXIHSJUDIKL-UHFFFAOYSA-N.
| Molecular formula | C10H12NO5P |
|---|---|
| Molecular weight | 257.18 g/mol |
| IUPAC name | 1-amino-5-phosphono-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | ZNQZXIHSJUDIKL-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C=C(C=C2)P(=O)(O)O)(C(=O)O)N |
Computed by PubChem (NCBI)