Products 1708984-11-5

CAS 1708984-11-5 is the registry number for N-(4-(9-Phenyl-9H-carbazol-3-yl)phenyl)dibenzo(b,d)thiophen-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-[4-(9-phenylcarbazol-3-yl)phenyl]dibenzothiophen-2-amine (CAS 1708984-11-5) is a chemical compound with the molecular formula C36H24N2S and a molecular weight of 516.7 g/mol. IUPAC name: N-[4-(9-phenylcarbazol-3-yl)phenyl]dibenzothiophen-2-amine. InChIKey: LUXWCBRFBBVMFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC36H24N2S
Molecular weight516.7 g/mol
IUPAC nameN-[4-(9-phenylcarbazol-3-yl)phenyl]dibenzothiophen-2-amine
InChIKeyLUXWCBRFBBVMFZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC=C(C=C4)NC5=CC6=C(C=C5)SC7=CC=CC=C76)C8=CC=CC=C82

Computed by PubChem (NCBI)