CAS 1708984-14-8 is the registry number for (4-((9,9-Dimethyl-9H-fluoren-2-yl)amino)phenyl)(phenyl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
[4-[(9,9-dimethylfluoren-2-yl)amino]phenyl]-phenylmethanone (CAS 1708984-14-8) is a chemical compound with the molecular formula C28H23NO and a molecular weight of 389.5 g/mol. IUPAC name: [4-[(9,9-dimethylfluoren-2-yl)amino]phenyl]-phenylmethanone. InChIKey: OQJDJBPMHJCLLS-UHFFFAOYSA-N.
| Molecular formula | C28H23NO |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | [4-[(9,9-dimethylfluoren-2-yl)amino]phenyl]-phenylmethanone |
| InChIKey | OQJDJBPMHJCLLS-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=CC=C(C=C4)C(=O)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)