CAS 170919-47-8 appears in our catalog under these names: 2,7-Bis(1-methyl-1-phenylethyl)-9H-fluorene, 2,7-Bis(1-methyl-1-phenylethyl)-9H-fluorene, >95%, >95%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,7-bis(2-phenylpropan-2-yl)-9H-fluorene (CAS 170919-47-8) is a chemical compound with the molecular formula C31H30 and a molecular weight of 402.6 g/mol. IUPAC name: 2,7-bis(2-phenylpropan-2-yl)-9H-fluorene. InChIKey: MWNTZMGXHKFEPS-UHFFFAOYSA-N.
| Molecular formula | C31H30 |
|---|---|
| Molecular weight | 402.6 g/mol |
| IUPAC name | 2,7-bis(2-phenylpropan-2-yl)-9H-fluorene |
| InChIKey | MWNTZMGXHKFEPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC3=C(C=C2)C4=C(C3)C=C(C=C4)C(C)(C)C5=CC=CC=C5 |
Computed by PubChem (NCBI)