CAS 17096-10-5 appears in our catalog under these names: 3–METHACRYLOXYPROPYLTRIS(VINYLDIMETHYLSILOXY)SILANE, 3-(3-((Dimethyl(vinyl)silyl)oxy)-1,1,5,5-tetramethyl-1,5-divinyltrisiloxan-3-yl)propyl methacrylate 95% mix BHT as stabilizer, 3-(3-((Dimethyl(vinyl)silyl)oxy)-1,1,5,5-tetramethyl-1,5-divinyltrisiloxan-3-yl)propyl methacrylate, 95% mix BHT as stabilizer, 95% mix BHT as stabilizer. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 50g, 1g, 5g, 10g, 25g, 100g, 500g.
3-tris[[ethenyl(dimethyl)silyl]oxy]silylpropyl 2-methylprop-2-enoate (CAS 17096-10-5) is a chemical compound with the molecular formula C19H38O5Si4 and a molecular weight of 458.8 g/mol. IUPAC name: 3-tris[[ethenyl(dimethyl)silyl]oxy]silylpropyl 2-methylprop-2-enoate. InChIKey: QPMLHNVAWXBESP-UHFFFAOYSA-N.
| Molecular formula | C19H38O5Si4 |
|---|---|
| Molecular weight | 458.8 g/mol |
| IUPAC name | 3-tris[[ethenyl(dimethyl)silyl]oxy]silylpropyl 2-methylprop-2-enoate |
| InChIKey | QPMLHNVAWXBESP-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C=C)(O[Si](C)(C)C=C)O[Si](C)(C)C=C |
Computed by PubChem (NCBI)