CAS 17096-12-7 appears in our catalog under these names: (3–acryloxypropyl)tris(trimethylsiloxy)silane, 3-[1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]trisiloxan-3-yl]propyl Acrylate (stabilized with BHT), >90.0%(GC), 3-(1,1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxan-3-yl)propyl acrylate 95%, 3-(1,1,1,5,5,5-Hexamethyl-3-((Trimethylsilyl)Oxy)Trisiloxan-3-Yl)Propyl Acrylate, 95%, 95%, (3-Acryloxypropyl)tris(trimethylsiloxy)silane inhibited with MEHQ tech-95, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
3-tris(trimethylsilyloxy)silylpropyl prop-2-enoate (CAS 17096-12-7) is a chemical compound with the molecular formula C15H36O5Si4 and a molecular weight of 408.78 g/mol. IUPAC name: 3-tris(trimethylsilyloxy)silylpropyl prop-2-enoate. InChIKey: PPBAWVJOPQUAMY-UHFFFAOYSA-N.
| Molecular formula | C15H36O5Si4 |
|---|---|
| Molecular weight | 408.78 g/mol |
| IUPAC name | 3-tris(trimethylsilyloxy)silylpropyl prop-2-enoate |
| InChIKey | PPBAWVJOPQUAMY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](CCCOC(=O)C=C)(O[Si](C)(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)