CAS 17097-76-6 appears in our catalog under these names: Hopantenate Calcium, >95% (HPLC), Hopantenate calcium, Calcium hopantenate, 95.00%, Calcium (R)-4-(2,4-Dihydroxy-3,3-dimethylbutanamido)butanoate. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 1mg, 2,5mg, 0,5g, 10mg, 100mg.
Calcium bis(4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoate) (CAS 17097-76-6) is a chemical compound with the molecular formula C20H36CaN2O10 and a molecular weight of 504.6 g/mol. IUPAC name: calcium bis(4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoate). InChIKey: OVXZVDMCQPLHIY-QXGOIDDHSA-L.
| Molecular formula | C20H36CaN2O10 |
|---|---|
| Molecular weight | 504.6 g/mol |
| IUPAC name | calcium bis(4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoate) |
| InChIKey | OVXZVDMCQPLHIY-QXGOIDDHSA-L |
| SMILES | CC(C)(CO)[C@H](C(=O)NCCCC(=O)[O-])O.CC(C)(CO)[C@H](C(=O)NCCCC(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)