CAS 170993-41-6 is the registry number for 2-(Chloromethyl)-1,3-benzoxazole-5-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(chloromethyl)-1,3-benzoxazole-5-carbonitrile (CAS 170993-41-6) is a chemical compound with the molecular formula C9H5ClN2O and a molecular weight of 192.60 g/mol. IUPAC name: 2-(chloromethyl)-1,3-benzoxazole-5-carbonitrile. InChIKey: DRJGTMOTYBEPCM-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O |
|---|---|
| Molecular weight | 192.60 g/mol |
| IUPAC name | 2-(chloromethyl)-1,3-benzoxazole-5-carbonitrile |
| InChIKey | DRJGTMOTYBEPCM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)N=C(O2)CCl |
Computed by PubChem (NCBI)