CAS 17103-66-1 is the registry number for Lithium metagallate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g.
Lithium 3,4,5-trihydroxybenzoate (CAS 17103-66-1) is a chemical compound with the molecular formula C7H5LiO5 and a molecular weight of 176.1 g/mol. IUPAC name: lithium 3,4,5-trihydroxybenzoate. InChIKey: MNKMDLVKGZBOEW-UHFFFAOYSA-M.
| Molecular formula | C7H5LiO5 |
|---|---|
| Molecular weight | 176.1 g/mol |
| IUPAC name | lithium 3,4,5-trihydroxybenzoate |
| InChIKey | MNKMDLVKGZBOEW-UHFFFAOYSA-M |
| SMILES | [Li+].C1=C(C=C(C(=C1O)O)O)C(=O)[O-] |
Computed by PubChem (NCBI)