Products 1710337-31-7
CAS 1710337-31-7 is the registry number for GS-493. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[2,5-bis(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid (CAS 1710337-31-7) is a chemical compound with the molecular formula C21H14N6O8S and a molecular weight of 510.4 g/mol. IUPAC name: 4-[[2,5-bis(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid. InChIKey: GVHLZSZTHCBBFC-UHFFFAOYSA-N.
| Molecular formula | C21H14N6O8S |
|---|---|
| Molecular weight | 510.4 g/mol |
| IUPAC name | 4-[[2,5-bis(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
| InChIKey | GVHLZSZTHCBBFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)N(N2)C3=CC=C(C=C3)[N+](=O)[O-])N=NC4=CC=C(C=C4)S(=O)(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)