CAS 1710834-39-1 is the registry number for diethyl 2,2'-(pyridine-2,5-diyl)bis(2,2-difluoroacetate). Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-[6-(2-ethoxy-1,1-difluoro-2-oxoethyl)-3-pyridinyl]-2,2-difluoroacetate (CAS 1710834-39-1) is a chemical compound with the molecular formula C13H13F4NO4 and a molecular weight of 323.24 g/mol. IUPAC name: ethyl 2-[6-(2-ethoxy-1,1-difluoro-2-oxoethyl)-3-pyridinyl]-2,2-difluoroacetate. InChIKey: DAKGMNLRUJUSTP-UHFFFAOYSA-N.
| Molecular formula | C13H13F4NO4 |
|---|---|
| Molecular weight | 323.24 g/mol |
| IUPAC name | ethyl 2-[6-(2-ethoxy-1,1-difluoro-2-oxoethyl)-3-pyridinyl]-2,2-difluoroacetate |
| InChIKey | DAKGMNLRUJUSTP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CN=C(C=C1)C(C(=O)OCC)(F)F)(F)F |
Computed by PubChem (NCBI)