Products 171092-49-2
CAS 171092-49-2 is the registry number for (2S)-2-Amino-2-cyclohexyl-1-(pyrrolidin-1-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-2-amino-2-cyclohexyl-1-pyrrolidin-1-ylethanone (CAS 171092-49-2) is a chemical compound with the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. IUPAC name: (2S)-2-amino-2-cyclohexyl-1-pyrrolidin-1-ylethanone. InChIKey: RWNSISJNBAQNTF-NSHDSACASA-N.
| Molecular formula | C12H22N2O |
|---|---|
| Molecular weight | 210.32 g/mol |
| IUPAC name | (2S)-2-amino-2-cyclohexyl-1-pyrrolidin-1-ylethanone |
| InChIKey | RWNSISJNBAQNTF-NSHDSACASA-N |
| SMILES | C1CCC(CC1)[C@@H](C(=O)N2CCCC2)N |
Computed by PubChem (NCBI)