CAS 1712346-84-3 is the registry number for 6-(3-Fluorophenoxy)-9H-purin-2-amine. Offered by: TRC. Available pack sizes: 500mg.
6-(3-fluorophenoxy)-7H-purin-2-amine (CAS 1712346-84-3) is a chemical compound with the molecular formula C11H8FN5O and a molecular weight of 245.21 g/mol. IUPAC name: 6-(3-fluorophenoxy)-7H-purin-2-amine. InChIKey: HSOZKEMBTWWVCZ-UHFFFAOYSA-N.
| Molecular formula | C11H8FN5O |
|---|---|
| Molecular weight | 245.21 g/mol |
| IUPAC name | 6-(3-fluorophenoxy)-7H-purin-2-amine |
| InChIKey | HSOZKEMBTWWVCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=NC(=NC3=C2NC=N3)N |
Computed by PubChem (NCBI)