CAS 17125-80-3 is the registry number for Barium Hexafluorosilicate. Offered by: TRC. Available pack sizes: 1g, 2,5g.
Barium(2+);hexafluorosilicon(2-) (CAS 17125-80-3) is a chemical compound with the molecular formula BaF6Si and a molecular weight of 279.40 g/mol. IUPAC name: barium(2+);hexafluorosilicon(2-). InChIKey: RRLMRHFZRPYSNK-UHFFFAOYSA-N.
| Molecular formula | BaF6Si |
|---|---|
| Molecular weight | 279.40 g/mol |
| IUPAC name | barium(2+);hexafluorosilicon(2-) |
| InChIKey | RRLMRHFZRPYSNK-UHFFFAOYSA-N |
| SMILES | F[Si-2](F)(F)(F)(F)F.[Ba+2] |
Computed by PubChem (NCBI)