CAS 1713160-63-4 is the registry number for 1-(Piperidin-3-ylmethyl)-1H-1,2,3-triazole-4-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(piperidin-3-ylmethyl)triazole-4-carboxamide;hydrochloride (CAS 1713160-63-4) is a chemical compound with the molecular formula C9H16ClN5O and a molecular weight of 245.71 g/mol. IUPAC name: 1-(piperidin-3-ylmethyl)triazole-4-carboxamide;hydrochloride. InChIKey: FYJSPUHJRUEAPF-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN5O |
|---|---|
| Molecular weight | 245.71 g/mol |
| IUPAC name | 1-(piperidin-3-ylmethyl)triazole-4-carboxamide;hydrochloride |
| InChIKey | FYJSPUHJRUEAPF-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)CN2C=C(N=N2)C(=O)N.Cl |
Computed by PubChem (NCBI)