CAS 1713160-77-0 is the registry number for tert-Butyl 4-amino-4-(3-(trifluoromethyl)phenyl)piperidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-amino-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate (CAS 1713160-77-0) is a chemical compound with the molecular formula C17H23F3N2O2 and a molecular weight of 344.37 g/mol. IUPAC name: tert-butyl 4-amino-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate. InChIKey: KMVWPDGLGCSRCV-UHFFFAOYSA-N.
| Molecular formula | C17H23F3N2O2 |
|---|---|
| Molecular weight | 344.37 g/mol |
| IUPAC name | tert-butyl 4-amino-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| InChIKey | KMVWPDGLGCSRCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)