CAS 171338-33-3 appears in our catalog under these names: Aprepitant Impurity 18, Aprepitant Impurity 18 p-Toluenesulfonate. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenylmorpholine (CAS 171338-33-3) is a chemical compound with the molecular formula C20H19F6NO2 and a molecular weight of 419.4 g/mol. IUPAC name: (2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenylmorpholine. InChIKey: UTDANMPTVJPQFZ-OCBCSQNSSA-N.
| Molecular formula | C20H19F6NO2 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenylmorpholine |
| InChIKey | UTDANMPTVJPQFZ-OCBCSQNSSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](NCCO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)