Products 1713477-43-0
CAS 1713477-43-0 appears in our catalog under these names: 1,7-Dihydro-2,7-dimethyl-6H-purin-6-one, 97%, 97%, 2,7-dimethyl-6,7-dihydro-3H-purin-6-one, 97%, 2,7-Dimethyl-1H-purin-6(7H)-one, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,7-dimethyl-1H-purin-6-one (CAS 1713477-43-0) is a chemical compound with the molecular formula C7H8N4O and a molecular weight of 164.16 g/mol. IUPAC name: 2,7-dimethyl-1H-purin-6-one. InChIKey: HODYANVTVAIKNJ-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 2,7-dimethyl-1H-purin-6-one |
| InChIKey | HODYANVTVAIKNJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=O)N1)N(C=N2)C |
Computed by PubChem (NCBI)