CAS 171429-39-3 appears in our catalog under these names: 3-(5-Carboxypentyl)-1,1,2-trimethyl-1H-benzo[e]indol-3-ium bromide, 96%, 3-(5-Carboxypentyl)-1,1,2-trimethyl-1H-benzo[e]indol-3-ium bromide, 95%, 3-(5-carboxypentyl)-1,1,2-trimethyl-1H-benzo[e]indol-3-ium bromide, 95%, 95%, 3-(5-Carboxypentyl)-1,1,2-trimethyl-1H-benzo(e)indolium Bromide. Offered by: Fluorochem, Ambeed, Chemat, Chemat Brand. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, on request.
6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hexanoic acid bromide (CAS 171429-39-3) is a chemical compound with the molecular formula C21H26BrNO2 and a molecular weight of 404.3 g/mol. IUPAC name: 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hexanoic acid bromide. InChIKey: XSXHHAQBMIWSEH-UHFFFAOYSA-N.
| Molecular formula | C21H26BrNO2 |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hexanoic acid bromide |
| InChIKey | XSXHHAQBMIWSEH-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=C(C1(C)C)C3=CC=CC=C3C=C2)CCCCCC(=O)O.[Br-] |
Computed by PubChem (NCBI)