CAS 171486-04-7 appears in our catalog under these names: 2–(6–Benzamido–9H–purin–9–yl)acetic acid, 6-Benzoylamino-9H-purine-9-acetic acid, 2-(6-Benzamido-9H-purin-9-yl)acetic acid 97%, 2-(6-Benzamido-9H-purin-9-yl)acetic acid, 95%+, 95%+, 6-BENZOYLAMINO-9H-PURINE-9-ACETIC ACID, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 2g, 5g, 10g, 25g.
2-(6-benzamidopurin-9-yl)acetic acid (CAS 171486-04-7) is a chemical compound with the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. IUPAC name: 2-(6-benzamidopurin-9-yl)acetic acid. InChIKey: XSEJMYVTSMVKPG-UHFFFAOYSA-N.
| Molecular formula | C14H11N5O3 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | 2-(6-benzamidopurin-9-yl)acetic acid |
| InChIKey | XSEJMYVTSMVKPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=NC=N2)N(C=N3)CC(=O)O |
Computed by PubChem (NCBI)