CAS 1715008-74-4 is the registry number for 1-(Tetrahydro-2H-pyran-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 1715008-74-4) is a chemical compound with the molecular formula C18H25BN2O3 and a molecular weight of 328.2 g/mol. IUPAC name: 1-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: GBUYLKQBBITTMO-UHFFFAOYSA-N.
| Molecular formula | C18H25BN2O3 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 1-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | GBUYLKQBBITTMO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C3=CC=CC=C23)C4CCCCO4 |
Computed by PubChem (NCBI)