CAS 1715020-82-8 appears in our catalog under these names: Isoprothiolane-d4, Isoprothiolane–d4. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2500μg, 2.5 mg.
Dipropan-2-yl 2-(4,4,5,5-tetradeuterio-1,3-dithiolan-2-ylidene)propanedioate (CAS 1715020-82-8) is a chemical compound with the molecular formula C12H18O4S2 and a molecular weight of 294.4 g/mol. IUPAC name: dipropan-2-yl 2-(4,4,5,5-tetradeuterio-1,3-dithiolan-2-ylidene)propanedioate. InChIKey: UFHLMYOGRXOCSL-NZLXMSDQSA-N.
| Molecular formula | C12H18O4S2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | dipropan-2-yl 2-(4,4,5,5-tetradeuterio-1,3-dithiolan-2-ylidene)propanedioate |
| InChIKey | UFHLMYOGRXOCSL-NZLXMSDQSA-N |
| SMILES | [2H]C1(C(SC(=C(C(=O)OC(C)C)C(=O)OC(C)C)S1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)