CAS 1715030-40-2 is the registry number for Rel-(1s,4s)-4-(5-amino-6-bromopyrazin-2-yl)-1-methylcyclohexan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(5-amino-6-bromopyrazin-2-yl)-1-methylcyclohexan-1-ol (CAS 1715030-40-2) is a chemical compound with the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. IUPAC name: 4-(5-amino-6-bromopyrazin-2-yl)-1-methylcyclohexan-1-ol. InChIKey: FXYROPMQFPQOGT-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN3O |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | 4-(5-amino-6-bromopyrazin-2-yl)-1-methylcyclohexan-1-ol |
| InChIKey | FXYROPMQFPQOGT-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)C2=CN=C(C(=N2)Br)N)O |
Computed by PubChem (NCBI)