Products 171564-43-5

CAS 171564-43-5 is the registry number for 2-[(1-Oxo-2-propen-1-yl)oxy]ethyl 9-anthracenecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-prop-2-enoyloxyethyl anthracene-9-carboxylate (CAS 171564-43-5) is a chemical compound with the molecular formula C20H16O4 and a molecular weight of 320.3 g/mol. IUPAC name: 2-prop-2-enoyloxyethyl anthracene-9-carboxylate. InChIKey: QTDGFNMINWUSKT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H16O4
Molecular weight320.3 g/mol
IUPAC name2-prop-2-enoyloxyethyl anthracene-9-carboxylate
InChIKeyQTDGFNMINWUSKT-UHFFFAOYSA-N
SMILESC=CC(=O)OCCOC(=O)C1=C2C=CC=CC2=CC3=CC=CC=C31

Computed by PubChem (NCBI)