Products 171569-40-7
CAS 171569-40-7 is the registry number for 3'-Hydroxyclomazone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
2-[(2-chloro-3-hydroxyphenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one (CAS 171569-40-7) is a chemical compound with the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. IUPAC name: 2-[(2-chloro-3-hydroxyphenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one. InChIKey: XMGWYYDBYIQXLC-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 2-[(2-chloro-3-hydroxyphenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one |
| InChIKey | XMGWYYDBYIQXLC-UHFFFAOYSA-N |
| SMILES | CC1(CON(C1=O)CC2=C(C(=CC=C2)O)Cl)C |
Computed by PubChem (NCBI)