CAS 17157-12-9 appears in our catalog under these names: Isoquinoline-d7, >95% (GC), Isoquinoline-d7, 97 atom % D, min 98% Chemical Purity, Isoquinoline–d7, Isoquinoline-d7, 98.04%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 25mg, 25 mg, 50 mg.
1,3,4,5,6,7,8-heptadeuterioisoquinoline (CAS 17157-12-9) is a chemical compound with the molecular formula C9H7N and a molecular weight of 136.20 g/mol. IUPAC name: 1,3,4,5,6,7,8-heptadeuterioisoquinoline. InChIKey: AWJUIBRHMBBTKR-GSNKEKJESA-N.
| Molecular formula | C9H7N |
|---|---|
| Molecular weight | 136.20 g/mol |
| IUPAC name | 1,3,4,5,6,7,8-heptadeuterioisoquinoline |
| InChIKey | AWJUIBRHMBBTKR-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=NC(=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)