CAS 1716-43-4 is the registry number for 2-Fluoro-3,4-dimethoxybenzylchloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(chloromethyl)-2-fluoro-3,4-dimethoxybenzene (CAS 1716-43-4) is a chemical compound with the molecular formula C9H10ClFO2 and a molecular weight of 204.62 g/mol. IUPAC name: 1-(chloromethyl)-2-fluoro-3,4-dimethoxybenzene. InChIKey: RASIHJHGNLXRPH-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFO2 |
|---|---|
| Molecular weight | 204.62 g/mol |
| IUPAC name | 1-(chloromethyl)-2-fluoro-3,4-dimethoxybenzene |
| InChIKey | RASIHJHGNLXRPH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CCl)F)OC |
Computed by PubChem (NCBI)