Products 171723-80-1

CAS 171723-80-1 is the registry number for Revefenacin Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1-benzylpiperidin-4-yl) N-(2-phenylphenyl)carbamate (CAS 171723-80-1) is a chemical compound with the molecular formula C25H26N2O2 and a molecular weight of 386.5 g/mol. IUPAC name: (1-benzylpiperidin-4-yl) N-(2-phenylphenyl)carbamate. InChIKey: MSHSHVZVLWLNIO-UHFFFAOYSA-N.

Identity
Molecular formulaC25H26N2O2
Molecular weight386.5 g/mol
IUPAC name(1-benzylpiperidin-4-yl) N-(2-phenylphenyl)carbamate
InChIKeyMSHSHVZVLWLNIO-UHFFFAOYSA-N
SMILESC1CN(CCC1OC(=O)NC2=CC=CC=C2C3=CC=CC=C3)CC4=CC=CC=C4

Computed by PubChem (NCBI)