Products 171744-11-9
CAS 171744-11-9 appears in our catalog under these names: GGTI–286, GGTI-286. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, Get quote.
Methyl (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-phenylbenzoyl]amino]-4-methylpentanoate (CAS 171744-11-9) is a chemical compound with the molecular formula C23H31N3O3S and a molecular weight of 429.6 g/mol. IUPAC name: methyl (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-phenylbenzoyl]amino]-4-methylpentanoate. InChIKey: IENQPUVVSDIXCT-UTKZUKDTSA-N.
| Molecular formula | C23H31N3O3S |
|---|---|
| Molecular weight | 429.6 g/mol |
| IUPAC name | methyl (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-phenylbenzoyl]amino]-4-methylpentanoate |
| InChIKey | IENQPUVVSDIXCT-UTKZUKDTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC(=O)C1=C(C=C(C=C1)NC[C@H](CS)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Ggti 286, orb1687664