CAS 171745-13-4 appears in our catalog under these names: N-(3-Bromophenyl)-6,7-diethoxyquinazolin-4-amine, 97%, Compound 56, EGFR-IN-80. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 500μg, 5mg, 10mM (in 1ml dmso), 500 μg.
N-(3-bromophenyl)-6,7-diethoxyquinazolin-4-amine (CAS 171745-13-4) is a chemical compound with the molecular formula C18H18BrN3O2 and a molecular weight of 388.3 g/mol. IUPAC name: N-(3-bromophenyl)-6,7-diethoxyquinazolin-4-amine. InChIKey: YXOXHAUUTIOBDA-UHFFFAOYSA-N.
| Molecular formula | C18H18BrN3O2 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | N-(3-bromophenyl)-6,7-diethoxyquinazolin-4-amine |
| InChIKey | YXOXHAUUTIOBDA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)Br)OCC |
Computed by PubChem (NCBI)