Products 171777-66-5
CAS 171777-66-5 appears in our catalog under these names: 4-Nitrobenzoic Acid-d4, >95% (HPLC), 4-Nitrobenzoic acid-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 25mg, 1 g, 25 mg, 100 mg.
2,3,5,6-tetradeuterio-4-nitrobenzoic acid (CAS 171777-66-5) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 171.14 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-nitrobenzoic acid. InChIKey: OTLNPYWUJOZPPA-RHQRLBAQSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-nitrobenzoic acid |
| InChIKey | OTLNPYWUJOZPPA-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)