Products 17184-05-3
CAS 17184-05-3 appears in our catalog under these names: Cyproterone Acetate Impurity 5（Cyproterone Acetate EP Impurity E）, Cyproterone Acetate EP Impurity E, 6-Keto Cyproterone Acetate, >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg.
[(1S,2S,3S,5R,11R,12S,15R,16S)-15-acetyl-2,16-dimethyl-6,9-dioxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-enyl] acetate (CAS 17184-05-3) is a chemical compound with the molecular formula C24H30O5 and a molecular weight of 398.5 g/mol. IUPAC name: [(1S,2S,3S,5R,11R,12S,15R,16S)-15-acetyl-2,16-dimethyl-6,9-dioxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-enyl] acetate. InChIKey: WIRUTYUSQYFQAC-FDTZYFLXSA-N.
| Molecular formula | C24H30O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | [(1S,2S,3S,5R,11R,12S,15R,16S)-15-acetyl-2,16-dimethyl-6,9-dioxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-enyl] acetate |
| InChIKey | WIRUTYUSQYFQAC-FDTZYFLXSA-N |
| SMILES | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC(=O)C4=CC(=O)[C@@H]5C[C@@H]5[C@]34C)C)OC(=O)C |
Computed by PubChem (NCBI)