Products 171869-95-7
CAS 171869-95-7 appears in our catalog under these names: Palmatine hydrochloride hydrate, 95.00%, Palmatine chloride hydrate 97 %, Palmatine chloride hydrate. Offered by: Chemat, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 25mg, 500mg, 10mg.
2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;chloride;hydrate (CAS 171869-95-7) is a chemical compound with the molecular formula C21H24ClNO5 and a molecular weight of 405.9 g/mol. IUPAC name: 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;chloride;hydrate. InChIKey: PIQNSCSNSSZUIT-UHFFFAOYSA-M.
| Molecular formula | C21H24ClNO5 |
|---|---|
| Molecular weight | 405.9 g/mol |
| IUPAC name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;chloride;hydrate |
| InChIKey | PIQNSCSNSSZUIT-UHFFFAOYSA-M |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.O.[Cl-] |
Computed by PubChem (NCBI)